C18H22O5 — CID 40543654
2-benzoyloxyethyl (1R,3S,6S)-3,6-dimethyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 40543654) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-benzoyloxyethyl (1R,3S,6S)-3,6-dimethyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | 2-benzoyloxyethyl (1R,3S,6S)-3,6-dimethyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 40543654 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-benzoyloxyethyl (1R,3S,6S)-3,6-dimethyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | C[C@]1(C(=O)OCCOC(=O)c2ccccc2)CC[C@]2(C)O[C@@H]2C1 |
| InChI | InChI=1S/C18H22O5/c1-17(8-9-18(2)14(12-17)23-18)16(20)22-11-10-21-15(19)13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3/t14-,17+,18+/m1/s1 |
| InChIKey | BZWBYIYAILBAGK-JLSDUUJJSA-N |
| XLogP | 2.73 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|