C26H37BO2 — CID 135048472
2-[(1S,2R,3S,5S)-3-(9-borabicyclo[3.3.1]nonan-9-yl)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethyl benzoate (PubChem CID 135048472) has the molecular formula C26H37BO2 and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-[(1S,2R,3S,5S)-3-(9-borabicyclo[3.3.1]nonan-9-yl)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethyl benzoate.
| Compound Name | 2-[(1S,2R,3S,5S)-3-(9-borabicyclo[3.3.1]nonan-9-yl)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethyl benzoate |
|---|---|
| PubChem CID | 135048472 |
| Molecular Formula | C26H37BO2 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 2-[(1S,2R,3S,5S)-3-(9-borabicyclo[3.3.1]nonan-9-yl)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethyl benzoate |
| SMILES | CC1(C)[C@H]2C[C@H](B3C4CCCC3CCC4)[C@@H](CCOC(=O)c3ccccc3)[C@@H]1C2 |
| InChI | InChI=1S/C26H37BO2/c1-26(2)19-16-23(26)22(14-15-29-25(28)18-8-4-3-5-9-18)24(17-19)27-20-10-6-11-21(27)13-7-12-20/h3-5,8-9,19-24H,6-7,10-17H2,1-2H3/t19-,20?,21?,22+,23+,24+/m1/s1 |
| InChIKey | ZQANKVTUNOCBOC-GXXADODDSA-N |
| XLogP | 6.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|