C16H20O3 — CID 143414183
2-(3-hydroxy-2-methylidenecyclohexyl)ethyl benzoate (PubChem CID 143414183) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-(3-hydroxy-2-methylidenecyclohexyl)ethyl benzoate.
| Compound Name | 2-(3-hydroxy-2-methylidenecyclohexyl)ethyl benzoate |
|---|---|
| PubChem CID | 143414183 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-(3-hydroxy-2-methylidenecyclohexyl)ethyl benzoate |
| SMILES | C=C1C(O)CCCC1CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O3/c1-12-13(8-5-9-15(12)17)10-11-19-16(18)14-6-3-2-4-7-14/h2-4,6-7,13,15,17H,1,5,8-11H2 |
| InChIKey | LKAYXIVOLCDQJV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|