C26H39BO — CID 155885405
9-[(1S,2R,3R,5S)-6,6-dimethyl-2-(2-phenylmethoxyethyl)-3-bicyclo[3.1.1]heptanyl]-9-borabicyclo[3.3.1]nonane (PubChem CID 155885405) has the molecular formula C26H39BO and a molecular weight of 378.41 g/mol. Its IUPAC name is 9-[(1S,2R,3R,5S)-6,6-dimethyl-2-(2-phenylmethoxyethyl)-3-bicyclo[3.1.1]heptanyl]-9-borabicyclo[3.3.1]nonane.
| Compound Name | 9-[(1S,2R,3R,5S)-6,6-dimethyl-2-(2-phenylmethoxyethyl)-3-bicyclo[3.1.1]heptanyl]-9-borabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 155885405 |
| Molecular Formula | C26H39BO |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 9-[(1S,2R,3R,5S)-6,6-dimethyl-2-(2-phenylmethoxyethyl)-3-bicyclo[3.1.1]heptanyl]-9-borabicyclo[3.3.1]nonane |
| SMILES | CC1(C)[C@H]2C[C@@H](B3C4CCCC3CCC4)[C@@H](CCOCc3ccccc3)[C@@H]1C2 |
| InChI | InChI=1S/C26H39BO/c1-26(2)20-16-24(26)23(14-15-28-18-19-8-4-3-5-9-19)25(17-20)27-21-10-6-11-22(27)13-7-12-21/h3-5,8-9,20-25H,6-7,10-18H2,1-2H3/t20-,21?,22?,23+,24+,25-/m1/s1 |
| InChIKey | OTFFBHKQLFFQNX-MOCODRKASA-N |
| XLogP | 7.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|