C19H28O3 — CID 11426684
cis-methyl (1S,2R)-3,3-dimethyl-2-(2-phenylmethoxyethyl)cyclohexane-1-carboxylate (PubChem CID 11426684) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is cis-methyl (1S,2R)-3,3-dimethyl-2-(2-phenylmethoxyethyl)cyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1S,2R)-3,3-dimethyl-2-(2-phenylmethoxyethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11426684 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | cis-methyl (1S,2R)-3,3-dimethyl-2-(2-phenylmethoxyethyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCCC(C)(C)[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C19H28O3/c1-19(2)12-7-10-16(18(20)21-3)17(19)11-13-22-14-15-8-5-4-6-9-15/h4-6,8-9,16-17H,7,10-14H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | ANSYVLAATJFIPP-DLBZAZTESA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|