C17H25NO3 — CID 142090727
methyl 4-(4-phenylmethoxybutyl)pyrrolidine-2-carboxylate (PubChem CID 142090727) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is methyl 4-(4-phenylmethoxybutyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-(4-phenylmethoxybutyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142090727 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | methyl 4-(4-phenylmethoxybutyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(CCCCOCc2ccccc2)CN1 |
| InChI | InChI=1S/C17H25NO3/c1-20-17(19)16-11-15(12-18-16)9-5-6-10-21-13-14-7-3-2-4-8-14/h2-4,7-8,15-16,18H,5-6,9-13H2,1H3 |
| InChIKey | YAQNMAULZFNTCV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|