C24H39NO — CID 67751430
N-benzyl-5-[2-[(1R,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethoxy]-N-methylpentan-1-amine (PubChem CID 67751430) has the molecular formula C24H39NO and a molecular weight of 357.58 g/mol. Its IUPAC name is N-benzyl-5-[2-[(1R,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethoxy]-N-methylpentan-1-amine.
| Compound Name | N-benzyl-5-[2-[(1R,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethoxy]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 67751430 |
| Molecular Formula | C24H39NO |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | N-benzyl-5-[2-[(1R,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethoxy]-N-methylpentan-1-amine |
| SMILES | CN(CCCCCOCC[C@@H]1CC[C@H]2C[C@H]1C2(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C24H39NO/c1-24(2)22-13-12-21(23(24)18-22)14-17-26-16-9-5-8-15-25(3)19-20-10-6-4-7-11-20/h4,6-7,10-11,21-23H,5,8-9,12-19H2,1-3H3/t21-,22-,23+/m0/s1 |
| InChIKey | ZJDVMYRZCLENLX-RJGXRXQPSA-N |
| XLogP | 5.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|