C36H56N2O5 — CID 20725912
6-[3-[benzyl-[4-[4-[benzyl(methyl)amino]butoxy]butyl]amino]propanoyloxy]hexyl butanoate (PubChem CID 20725912) has the molecular formula C36H56N2O5 and a molecular weight of 596.85 g/mol. Its IUPAC name is 6-[3-[benzyl-[4-[4-[benzyl(methyl)amino]butoxy]butyl]amino]propanoyloxy]hexyl butanoate.
| Compound Name | 6-[3-[benzyl-[4-[4-[benzyl(methyl)amino]butoxy]butyl]amino]propanoyloxy]hexyl butanoate |
|---|---|
| PubChem CID | 20725912 |
| Molecular Formula | C36H56N2O5 |
| Molecular Weight | 596.85 g/mol |
| Exact Mass | 596.42 |
| IUPAC Name | 6-[3-[benzyl-[4-[4-[benzyl(methyl)amino]butoxy]butyl]amino]propanoyloxy]hexyl butanoate |
| SMILES | CCCC(=O)OCCCCCCOC(=O)CCN(CCCCOCCCCN(C)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H56N2O5/c1-3-18-35(39)42-29-14-4-5-15-30-43-36(40)23-26-38(32-34-21-10-7-11-22-34)25-13-17-28-41-27-16-12-24-37(2)31-33-19-8-6-9-20-33/h6-11,19-22H,3-5,12-18,23-32H2,1-2H3 |
| InChIKey | VJIBEEVFESWCEM-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.85 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|