C20H27NO3 — CID 10042224
[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (2S)-2-benzamidopropanoate (PubChem CID 10042224) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is [(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (2S)-2-benzamidopropanoate.
| Compound Name | [(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (2S)-2-benzamidopropanoate |
|---|---|
| PubChem CID | 10042224 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | [(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (2S)-2-benzamidopropanoate |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1OC(=O)[C@H](C)NC(=O)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C20H27NO3/c1-12-16-10-15(20(16,3)4)11-17(12)24-19(23)13(2)21-18(22)14-8-6-5-7-9-14/h5-9,12-13,15-17H,10-11H2,1-4H3,(H,21,22)/t12-,13+,15+,16-,17-/m1/s1 |
| InChIKey | DDRICZXDHWKZBB-PNDGYWDASA-N |
| XLogP | 3.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |