C18H25NO4 — CID 124734915
[(1S,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (2S)-2-(furan-3-carbonylamino)propanoate (PubChem CID 124734915) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is [(1S,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (2S)-2-(furan-3-carbonylamino)propanoate.
| Compound Name | [(1S,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (2S)-2-(furan-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 124734915 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | [(1S,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (2S)-2-(furan-3-carbonylamino)propanoate |
| SMILES | C[C@@H]1[C@H](OC(=O)[C@H](C)NC(=O)c2ccoc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C18H25NO4/c1-10-14-7-13(18(14,3)4)8-15(10)23-17(21)11(2)19-16(20)12-5-6-22-9-12/h5-6,9-11,13-15H,7-8H2,1-4H3,(H,19,20)/t10-,11-,13+,14-,15+/m0/s1 |
| InChIKey | MVDRHQGWNVQXLW-ZYDPBQMLSA-N |
| XLogP | 3.01 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |