About [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate
[2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate (PubChem CID 11396593) has the molecular formula C22H26N2O6Si
and a molecular weight of 442.54 g/mol. Its IUPAC name is [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate.
Molecular Properties
| Compound Name | [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate |
| PubChem CID | 11396593 |
| Molecular Formula | C22H26N2O6Si |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate |
| SMILES | CC(NC(=O)c1ccccc1)C(=O)O[Si](C)(C)OC(=O)C(C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O6Si/c1-15(23-19(25)17-11-7-5-8-12-17)21(27)29-31(3,4)30-22(28)16(2)24-20(26)18-13-9-6-10-14-18/h5-16H,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | LQFNVRRRYGYWQP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate?
The IUPAC name of [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate (CID 11396593) is [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate.
What is the SMILES notation for [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate?
The canonical SMILES for [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate is CC(NC(=O)c1ccccc1)C(=O)O[Si](C)(C)OC(=O)C(C)NC(=O)c1ccccc1.
What is the InChIKey of [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate?
The InChIKey is LQFNVRRRYGYWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O6Si/c1-15(23-19(25)17-11-7-5-8-12-17)21(27)29-31(3,4)30-22(28)16(2)24-20(26)18-13-9-6-10-14-18/h5-16H,1-4H3,(H,23,25)(H,24,26).
What are the key properties of [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate?
[2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate has a molecular weight of 442.54 g/mol, XLogP of 2.41, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-benzamidopropanoyloxy(dimethyl)silyl] 2-benzamidopropanoate is sourced from PubChem (CID 11396593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).