C21H25NO4 — CID 51730299
[(1R,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 51730299) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is [(1R,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [(1R,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 51730299 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [(1R,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | C[C@H]1[C@@H](OC(=O)c2cccc(N3C(=O)CCC3=O)c2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C21H25NO4/c1-12-16-10-14(21(16,2)3)11-17(12)26-20(25)13-5-4-6-15(9-13)22-18(23)7-8-19(22)24/h4-6,9,12,14,16-17H,7-8,10-11H2,1-3H3/t12-,14+,16-,17+/m1/s1 |
| InChIKey | IGPLREQKGCQVKF-UOJCXKCYSA-N |
| XLogP | 3.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|