C18H21N3O2S — CID 99617974
[(1R,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate (PubChem CID 99617974) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is [(1R,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate.
| Compound Name | [(1R,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 99617974 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(1R,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate |
| SMILES | C[C@@H]1[C@@H](OC(=O)c2csc(-c3ncccn3)n2)C[C@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C18H21N3O2S/c1-10-12-7-11(18(12,2)3)8-14(10)23-17(22)13-9-24-16(21-13)15-19-5-4-6-20-15/h4-6,9-12,14H,7-8H2,1-3H3/t10-,11+,12+,14-/m0/s1 |
| InChIKey | XPMVWCQXJFKUNL-SFTQSGBHSA-N |
| XLogP | 3.83 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |