C25H24O3 — CID 100989331
[(1R,2S)-2-(naphthalen-1-ylmethyl)cyclohexyl] 2-oxo-2-phenylacetate (PubChem CID 100989331) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(1R,2S)-2-(naphthalen-1-ylmethyl)cyclohexyl] 2-oxo-2-phenylacetate.
| Compound Name | [(1R,2S)-2-(naphthalen-1-ylmethyl)cyclohexyl] 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 100989331 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [(1R,2S)-2-(naphthalen-1-ylmethyl)cyclohexyl] 2-oxo-2-phenylacetate |
| SMILES | O=C(O[C@@H]1CCCC[C@H]1Cc1cccc2ccccc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24O3/c26-24(19-10-2-1-3-11-19)25(27)28-23-16-7-5-12-21(23)17-20-14-8-13-18-9-4-6-15-22(18)20/h1-4,6,8-11,13-15,21,23H,5,7,12,16-17H2/t21-,23+/m0/s1 |
| InChIKey | QHIIOCYBGCOLJK-JTHBVZDNSA-N |
| XLogP | 5.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|