C19H22N2O2 — CID 3815100
[(1-amino-2-naphthalen-1-ylethylidene)amino] cyclohexanecarboxylate (PubChem CID 3815100) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is [(1-amino-2-naphthalen-1-ylethylidene)amino] cyclohexanecarboxylate.
| Compound Name | [(1-amino-2-naphthalen-1-ylethylidene)amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 3815100 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [(1-amino-2-naphthalen-1-ylethylidene)amino] cyclohexanecarboxylate |
| SMILES | NC(Cc1cccc2ccccc12)=NOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H22N2O2/c20-18(21-23-19(22)15-8-2-1-3-9-15)13-16-11-6-10-14-7-4-5-12-17(14)16/h4-7,10-12,15H,1-3,8-9,13H2,(H2,20,21) |
| InChIKey | SQLCVPSBXNHBCG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|