C29H30O3 — CID 15833965
[(1S,2R)-2-[2-(4-phenylphenyl)propan-2-yl]cyclohexyl] 2-oxo-2-phenylacetate (PubChem CID 15833965) has the molecular formula C29H30O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is [(1S,2R)-2-[2-(4-phenylphenyl)propan-2-yl]cyclohexyl] 2-oxo-2-phenylacetate.
| Compound Name | [(1S,2R)-2-[2-(4-phenylphenyl)propan-2-yl]cyclohexyl] 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 15833965 |
| Molecular Formula | C29H30O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [(1S,2R)-2-[2-(4-phenylphenyl)propan-2-yl]cyclohexyl] 2-oxo-2-phenylacetate |
| SMILES | CC(C)(c1ccc(-c2ccccc2)cc1)[C@H]1CCCC[C@@H]1OC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H30O3/c1-29(2,24-19-17-22(18-20-24)21-11-5-3-6-12-21)25-15-9-10-16-26(25)32-28(31)27(30)23-13-7-4-8-14-23/h3-8,11-14,17-20,25-26H,9-10,15-16H2,1-2H3/t25-,26-/m0/s1 |
| InChIKey | ZZJBWAHWFWTTLK-UIOOFZCWSA-N |
| XLogP | 6.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|