C26H35NO3 — CID 10319350
[(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-4-oxo-2-pent-4-enyl-2,3-dihydropyridine-1-carboxylate (PubChem CID 10319350) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is [(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-4-oxo-2-pent-4-enyl-2,3-dihydropyridine-1-carboxylate.
| Compound Name | [(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-4-oxo-2-pent-4-enyl-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 10319350 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | [(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-4-oxo-2-pent-4-enyl-2,3-dihydropyridine-1-carboxylate |
| SMILES | C=CCCC[C@H]1CC(=O)C=CN1C(=O)O[C@H]1CCCC[C@@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H35NO3/c1-4-5-7-14-21-19-22(28)17-18-27(21)25(29)30-24-16-11-10-15-23(24)26(2,3)20-12-8-6-9-13-20/h4,6,8-9,12-13,17-18,21,23-24H,1,5,7,10-11,14-16,19H2,2-3H3/t21-,23-,24-/m0/s1 |
| InChIKey | SSPGIZXBVWYZGE-XWGVYQGASA-N |
| XLogP | 6.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|