C37H59NO5Si — CID 100968199
[(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-oxo-5-tri(propan-2-yl)silyl-2,3-dihydropyridine-1-carboxylate (PubChem CID 100968199) has the molecular formula C37H59NO5Si and a molecular weight of 625.97 g/mol. Its IUPAC name is [(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-oxo-5-tri(propan-2-yl)silyl-2,3-dihydropyridine-1-carboxylate.
| Compound Name | [(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-oxo-5-tri(propan-2-yl)silyl-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 100968199 |
| Molecular Formula | C37H59NO5Si |
| Molecular Weight | 625.97 g/mol |
| Exact Mass | 625.42 |
| IUPAC Name | [(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-oxo-5-tri(propan-2-yl)silyl-2,3-dihydropyridine-1-carboxylate |
| SMILES | CCC1(CC)OC[C@H]([C@@H]2CC(=O)C([Si](C(C)C)(C(C)C)C(C)C)=CN2C(=O)O[C@H]2CCCC[C@@H]2C(C)(C)c2ccccc2)O1 |
| InChI | InChI=1S/C37H59NO5Si/c1-11-37(12-2)41-24-33(43-37)30-22-31(39)34(44(25(3)4,26(5)6)27(7)8)23-38(30)35(40)42-32-21-17-16-20-29(32)36(9,10)28-18-14-13-15-19-28/h13-15,18-19,23,25-27,29-30,32-33H,11-12,16-17,20-22,24H2,1-10H3/t29-,30-,32-,33+/m0/s1 |
| InChIKey | NLXPIYBQAXRGKC-NIRAYWGMSA-N |
| XLogP | 9.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.97 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|