C19H28LiO5P — CID 11559809
lithium (E)-2-dimethoxyphosphoryl-1-[(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl]oxyethenolate (PubChem CID 11559809) has the molecular formula C19H28LiO5P and a molecular weight of 374.34 g/mol. Its IUPAC name is lithium (E)-2-dimethoxyphosphoryl-1-[(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl]oxyethenolate.
| Compound Name | lithium (E)-2-dimethoxyphosphoryl-1-[(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl]oxyethenolate |
|---|---|
| PubChem CID | 11559809 |
| Molecular Formula | C19H28LiO5P |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | lithium (E)-2-dimethoxyphosphoryl-1-[(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl]oxyethenolate |
| SMILES | COP(=O)(/C=C(\[O-])O[C@H]1CCCC[C@@H]1C(C)(C)c1ccccc1)OC.[Li+] |
| InChI | InChI=1S/C19H29O5P.Li/c1-19(2,15-10-6-5-7-11-15)16-12-8-9-13-17(16)24-18(20)14-25(21,22-3)23-4;/h5-7,10-11,14,16-17,20H,8-9,12-13H2,1-4H3;/q;+1/p-1/b18-14+;/t16-,17-;/m0./s1 |
| InChIKey | NJYAACOMVPSPKK-VFDIIJODSA-M |
| XLogP | 1.19 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|