C40H43NO3Si — CID 15151504
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-4-oxo-2-triphenylsilyl-2,3-dihydropyridine-1-carboxylate (PubChem CID 15151504) has the molecular formula C40H43NO3Si and a molecular weight of 613.87 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-4-oxo-2-triphenylsilyl-2,3-dihydropyridine-1-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-4-oxo-2-triphenylsilyl-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 15151504 |
| Molecular Formula | C40H43NO3Si |
| Molecular Weight | 613.87 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-4-oxo-2-triphenylsilyl-2,3-dihydropyridine-1-carboxylate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)N2C=CC(=O)C[C@@H]2[Si](c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C40H43NO3Si/c1-30-24-25-36(40(2,3)31-16-8-4-9-17-31)37(28-30)44-39(43)41-27-26-32(42)29-38(41)45(33-18-10-5-11-19-33,34-20-12-6-13-21-34)35-22-14-7-15-23-35/h4-23,26-27,30,36-38H,24-25,28-29H2,1-3H3/t30-,36-,37-,38+/m1/s1 |
| InChIKey | JPLKYBQSSLYVCU-RYXAULCRSA-N |
| XLogP | 6.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.87 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|