C22H27O3P — CID 141088257
(2S,3R)-2-(diphenoxyphosphanylmethyl)-6,6-dimethylbicyclo[3.1.1]heptan-3-ol (PubChem CID 141088257) has the molecular formula C22H27O3P and a molecular weight of 370.43 g/mol. Its IUPAC name is (2S,3R)-2-(diphenoxyphosphanylmethyl)-6,6-dimethylbicyclo[3.1.1]heptan-3-ol.
| Compound Name | (2S,3R)-2-(diphenoxyphosphanylmethyl)-6,6-dimethylbicyclo[3.1.1]heptan-3-ol |
|---|---|
| PubChem CID | 141088257 |
| Molecular Formula | C22H27O3P |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (2S,3R)-2-(diphenoxyphosphanylmethyl)-6,6-dimethylbicyclo[3.1.1]heptan-3-ol |
| SMILES | CC1(C)C2CC1[C@H](CP(Oc1ccccc1)Oc1ccccc1)[C@H](O)C2 |
| InChI | InChI=1S/C22H27O3P/c1-22(2)16-13-20(22)19(21(23)14-16)15-26(24-17-9-5-3-6-10-17)25-18-11-7-4-8-12-18/h3-12,16,19-21,23H,13-15H2,1-2H3/t16?,19-,20?,21+/m0/s1 |
| InChIKey | BSARTUGYJONTNY-DVXGCZRDSA-N |
| XLogP | 5.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|