C13H19NO — CID 97041991
trans-(1R,3R)-N,2,2-trimethyl-3-phenoxycyclobutan-1-amine (PubChem CID 97041991) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is trans-(1R,3R)-N,2,2-trimethyl-3-phenoxycyclobutan-1-amine.
| Compound Name | trans-(1R,3R)-N,2,2-trimethyl-3-phenoxycyclobutan-1-amine |
|---|---|
| PubChem CID | 97041991 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | trans-(1R,3R)-N,2,2-trimethyl-3-phenoxycyclobutan-1-amine |
| SMILES | CN[C@@H]1C[C@@H](Oc2ccccc2)C1(C)C |
| InChI | InChI=1S/C13H19NO/c1-13(2)11(14-3)9-12(13)15-10-7-5-4-6-8-10/h4-8,11-12,14H,9H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | AUBPIXRPSSUKAZ-VXGBXAGGSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |