C13H17Br2NO — CID 66352255
3-(2,4-dibromophenoxy)-N,2,2-trimethylcyclobutan-1-amine (PubChem CID 66352255) has the molecular formula C13H17Br2NO and a molecular weight of 363.09 g/mol. Its IUPAC name is 3-(2,4-dibromophenoxy)-N,2,2-trimethylcyclobutan-1-amine.
| Compound Name | 3-(2,4-dibromophenoxy)-N,2,2-trimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 66352255 |
| Molecular Formula | C13H17Br2NO |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 3-(2,4-dibromophenoxy)-N,2,2-trimethylcyclobutan-1-amine |
| SMILES | CNC1CC(Oc2ccc(Br)cc2Br)C1(C)C |
| InChI | InChI=1S/C13H17Br2NO/c1-13(2)11(16-3)7-12(13)17-10-5-4-8(14)6-9(10)15/h4-6,11-12,16H,7H2,1-3H3 |
| InChIKey | IJMQZPHPIRDLBD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |