C17H23Br2NO — CID 66352926
3-(2,4-dibromophenoxy)-N-propylspiro[3.4]octan-1-amine (PubChem CID 66352926) has the molecular formula C17H23Br2NO and a molecular weight of 417.19 g/mol. Its IUPAC name is 3-(2,4-dibromophenoxy)-N-propylspiro[3.4]octan-1-amine.
| Compound Name | 3-(2,4-dibromophenoxy)-N-propylspiro[3.4]octan-1-amine |
|---|---|
| PubChem CID | 66352926 |
| Molecular Formula | C17H23Br2NO |
| Molecular Weight | 417.19 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 3-(2,4-dibromophenoxy)-N-propylspiro[3.4]octan-1-amine |
| SMILES | CCCNC1CC(Oc2ccc(Br)cc2Br)C12CCCC2 |
| InChI | InChI=1S/C17H23Br2NO/c1-2-9-20-15-11-16(17(15)7-3-4-8-17)21-14-6-5-12(18)10-13(14)19/h5-6,10,15-16,20H,2-4,7-9,11H2,1H3 |
| InChIKey | ZADLSETUNNKXEV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.19 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |