C16H21BrFNO — CID 66359577
3-(2-bromo-4-fluorophenoxy)-N-ethylspiro[3.4]octan-1-amine (PubChem CID 66359577) has the molecular formula C16H21BrFNO and a molecular weight of 342.25 g/mol. Its IUPAC name is 3-(2-bromo-4-fluorophenoxy)-N-ethylspiro[3.4]octan-1-amine.
| Compound Name | 3-(2-bromo-4-fluorophenoxy)-N-ethylspiro[3.4]octan-1-amine |
|---|---|
| PubChem CID | 66359577 |
| Molecular Formula | C16H21BrFNO |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 3-(2-bromo-4-fluorophenoxy)-N-ethylspiro[3.4]octan-1-amine |
| SMILES | CCNC1CC(Oc2ccc(F)cc2Br)C12CCCC2 |
| InChI | InChI=1S/C16H21BrFNO/c1-2-19-14-10-15(16(14)7-3-4-8-16)20-13-6-5-11(18)9-12(13)17/h5-6,9,14-15,19H,2-4,7-8,10H2,1H3 |
| InChIKey | DBOBRFPCXUYQPH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |