C16H20BrCl2NO — CID 107662308
3-(4-bromo-2,5-dichlorophenoxy)-N-ethylspiro[3.4]octan-1-amine (PubChem CID 107662308) has the molecular formula C16H20BrCl2NO and a molecular weight of 393.15 g/mol. Its IUPAC name is 3-(4-bromo-2,5-dichlorophenoxy)-N-ethylspiro[3.4]octan-1-amine.
| Compound Name | 3-(4-bromo-2,5-dichlorophenoxy)-N-ethylspiro[3.4]octan-1-amine |
|---|---|
| PubChem CID | 107662308 |
| Molecular Formula | C16H20BrCl2NO |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 3-(4-bromo-2,5-dichlorophenoxy)-N-ethylspiro[3.4]octan-1-amine |
| SMILES | CCNC1CC(Oc2cc(Cl)c(Br)cc2Cl)C12CCCC2 |
| InChI | InChI=1S/C16H20BrCl2NO/c1-2-20-14-9-15(16(14)5-3-4-6-16)21-13-8-11(18)10(17)7-12(13)19/h7-8,14-15,20H,2-6,9H2,1H3 |
| InChIKey | VDPAVRZHKMIIBA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|