C15H20BrCl2NO — CID 107662304
3-(4-bromo-2,5-dichlorophenoxy)-2,2-diethyl-N-methylcyclobutan-1-amine (PubChem CID 107662304) has the molecular formula C15H20BrCl2NO and a molecular weight of 381.14 g/mol. Its IUPAC name is 3-(4-bromo-2,5-dichlorophenoxy)-2,2-diethyl-N-methylcyclobutan-1-amine.
| Compound Name | 3-(4-bromo-2,5-dichlorophenoxy)-2,2-diethyl-N-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 107662304 |
| Molecular Formula | C15H20BrCl2NO |
| Molecular Weight | 381.14 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 3-(4-bromo-2,5-dichlorophenoxy)-2,2-diethyl-N-methylcyclobutan-1-amine |
| SMILES | CCC1(CC)C(NC)CC1Oc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C15H20BrCl2NO/c1-4-15(5-2)13(19-3)8-14(15)20-12-7-10(17)9(16)6-11(12)18/h6-7,13-14,19H,4-5,8H2,1-3H3 |
| InChIKey | UCCOTZDFHCMNTK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.14 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|