C14H19Cl2NO — CID 66357069
3-(3,5-dichlorophenoxy)-2-ethyl-N,2-dimethylcyclobutan-1-amine (PubChem CID 66357069) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is 3-(3,5-dichlorophenoxy)-2-ethyl-N,2-dimethylcyclobutan-1-amine.
| Compound Name | 3-(3,5-dichlorophenoxy)-2-ethyl-N,2-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 66357069 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-(3,5-dichlorophenoxy)-2-ethyl-N,2-dimethylcyclobutan-1-amine |
| SMILES | CCC1(C)C(NC)CC1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2NO/c1-4-14(2)12(17-3)8-13(14)18-11-6-9(15)5-10(16)7-11/h5-7,12-13,17H,4,8H2,1-3H3 |
| InChIKey | WARAIPKCGWLTHC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |