C17H23BrFNO — CID 66357153
3-(2-bromo-4-fluorophenoxy)-N-methylspiro[3.6]decan-1-amine (PubChem CID 66357153) has the molecular formula C17H23BrFNO and a molecular weight of 356.28 g/mol. Its IUPAC name is 3-(2-bromo-4-fluorophenoxy)-N-methylspiro[3.6]decan-1-amine.
| Compound Name | 3-(2-bromo-4-fluorophenoxy)-N-methylspiro[3.6]decan-1-amine |
|---|---|
| PubChem CID | 66357153 |
| Molecular Formula | C17H23BrFNO |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3-(2-bromo-4-fluorophenoxy)-N-methylspiro[3.6]decan-1-amine |
| SMILES | CNC1CC(Oc2ccc(F)cc2Br)C12CCCCCC2 |
| InChI | InChI=1S/C17H23BrFNO/c1-20-15-11-16(17(15)8-4-2-3-5-9-17)21-14-7-6-12(19)10-13(14)18/h6-7,10,15-16,20H,2-5,8-9,11H2,1H3 |
| InChIKey | LJYSEKROVXHYIE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |