C13H17FN2O3 — CID 66350692
3-(4-fluoro-2-nitrophenoxy)-N,2,2-trimethylcyclobutan-1-amine (PubChem CID 66350692) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-(4-fluoro-2-nitrophenoxy)-N,2,2-trimethylcyclobutan-1-amine.
| Compound Name | 3-(4-fluoro-2-nitrophenoxy)-N,2,2-trimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 66350692 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-(4-fluoro-2-nitrophenoxy)-N,2,2-trimethylcyclobutan-1-amine |
| SMILES | CNC1CC(Oc2ccc(F)cc2[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C13H17FN2O3/c1-13(2)11(15-3)7-12(13)19-10-5-4-8(14)6-9(10)16(17)18/h4-6,11-12,15H,7H2,1-3H3 |
| InChIKey | NGQJYTRXQHOSJO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|