C14H17BrFNO3 — CID 66343915
1-(3-bromo-2,2-diethylcyclobutyl)oxy-4-fluoro-2-nitrobenzene (PubChem CID 66343915) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is 1-(3-bromo-2,2-diethylcyclobutyl)oxy-4-fluoro-2-nitrobenzene.
| Compound Name | 1-(3-bromo-2,2-diethylcyclobutyl)oxy-4-fluoro-2-nitrobenzene |
|---|---|
| PubChem CID | 66343915 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 1-(3-bromo-2,2-diethylcyclobutyl)oxy-4-fluoro-2-nitrobenzene |
| SMILES | CCC1(CC)C(Br)CC1Oc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17BrFNO3/c1-3-14(4-2)12(15)8-13(14)20-11-6-5-9(16)7-10(11)17(18)19/h5-7,12-13H,3-4,8H2,1-2H3 |
| InChIKey | QLGSKHNUMMBMOX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|