C15H19Br2NO3 — CID 79842293
5-bromo-2-(3-bromo-2,2-diethylcyclobutyl)oxy-1-methyl-3-nitrobenzene (PubChem CID 79842293) has the molecular formula C15H19Br2NO3 and a molecular weight of 421.13 g/mol. Its IUPAC name is 5-bromo-2-(3-bromo-2,2-diethylcyclobutyl)oxy-1-methyl-3-nitrobenzene.
| Compound Name | 5-bromo-2-(3-bromo-2,2-diethylcyclobutyl)oxy-1-methyl-3-nitrobenzene |
|---|---|
| PubChem CID | 79842293 |
| Molecular Formula | C15H19Br2NO3 |
| Molecular Weight | 421.13 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 5-bromo-2-(3-bromo-2,2-diethylcyclobutyl)oxy-1-methyl-3-nitrobenzene |
| SMILES | CCC1(CC)C(Br)CC1Oc1c(C)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19Br2NO3/c1-4-15(5-2)12(17)8-13(15)21-14-9(3)6-10(16)7-11(14)18(19)20/h6-7,12-13H,4-5,8H2,1-3H3 |
| InChIKey | IBRAACTZGOQXTA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.13 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|