C14H17ClFNO3 — CID 66343389
2-(3-chloro-2,2-diethylcyclobutyl)oxy-4-fluoro-1-nitrobenzene (PubChem CID 66343389) has the molecular formula C14H17ClFNO3 and a molecular weight of 301.75 g/mol. Its IUPAC name is 2-(3-chloro-2,2-diethylcyclobutyl)oxy-4-fluoro-1-nitrobenzene.
| Compound Name | 2-(3-chloro-2,2-diethylcyclobutyl)oxy-4-fluoro-1-nitrobenzene |
|---|---|
| PubChem CID | 66343389 |
| Molecular Formula | C14H17ClFNO3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(3-chloro-2,2-diethylcyclobutyl)oxy-4-fluoro-1-nitrobenzene |
| SMILES | CCC1(CC)C(Cl)CC1Oc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17ClFNO3/c1-3-14(4-2)12(15)8-13(14)20-11-7-9(16)5-6-10(11)17(18)19/h5-7,12-13H,3-4,8H2,1-2H3 |
| InChIKey | XLPIDMJSMWIYBR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|