C25H36O2 — CID 11516191
(8R,9S,13S,14S,17S)-16-hex-5-enyl-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 11516191) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-16-hex-5-enyl-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-16-hex-5-enyl-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 11516191 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (8R,9S,13S,14S,17S)-16-hex-5-enyl-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C=CCCCCC1C[C@H]2[C@@H]3CCc4cc(OC)ccc4[C@H]3CC[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C25H36O2/c1-4-5-6-7-8-18-16-23-22-11-9-17-15-19(27-3)10-12-20(17)21(22)13-14-25(23,2)24(18)26/h4,10,12,15,18,21-24,26H,1,5-9,11,13-14,16H2,2-3H3/t18?,21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | FTSPCVZSXNVGFK-NJSDMCDASA-N |
| XLogP | 5.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|