C25H33NO2 — CID 102124391
(8R,9S,13S,14S,16S,17S)-16-(cyclopenta-2,4-dien-1-ylmethylamino)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 102124391) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is (8R,9S,13S,14S,16S,17S)-16-(cyclopenta-2,4-dien-1-ylmethylamino)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,16S,17S)-16-(cyclopenta-2,4-dien-1-ylmethylamino)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 102124391 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (8R,9S,13S,14S,16S,17S)-16-(cyclopenta-2,4-dien-1-ylmethylamino)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@H](O)[C@@H](NCC3C=CC=C3)C[C@@H]12 |
| InChI | InChI=1S/C25H33NO2/c1-25-12-11-20-19-10-8-18(28-2)13-17(19)7-9-21(20)22(25)14-23(24(25)27)26-15-16-5-3-4-6-16/h3-6,8,10,13,16,20-24,26-27H,7,9,11-12,14-15H2,1-2H3/t20-,21-,22+,23+,24-,25+/m1/s1 |
| InChIKey | TYXHUCONUHQJEX-LUXCBIKGSA-N |
| XLogP | 4.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |