C37H45NO6 — CID 77396005
[3-hydroxy-4-[[(17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl)amino]methyl]phenyl] 4-butoxybenzoate (PubChem CID 77396005) has the molecular formula C37H45NO6 and a molecular weight of 599.77 g/mol. Its IUPAC name is [3-hydroxy-4-[[(17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl)amino]methyl]phenyl] 4-butoxybenzoate.
| Compound Name | [3-hydroxy-4-[[(17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl)amino]methyl]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 77396005 |
| Molecular Formula | C37H45NO6 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | [3-hydroxy-4-[[(17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl)amino]methyl]phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(CNC3CC4C5CCc6cc(OC)ccc6C5CCC4(C)C3O)c(O)c2)cc1 |
| InChI | InChI=1S/C37H45NO6/c1-4-5-18-43-26-10-6-23(7-11-26)36(41)44-28-12-8-25(34(39)20-28)22-38-33-21-32-31-14-9-24-19-27(42-3)13-15-29(24)30(31)16-17-37(32,2)35(33)40/h6-8,10-13,15,19-20,30-33,35,38-40H,4-5,9,14,16-18,21-22H2,1-3H3 |
| InChIKey | WHVYLTGKMGDEME-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|