C33H37NO5 — CID 156579185
[3-hydroxy-4-[[(8R,9S,13S,14S,16R,17R)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-methylamino]phenyl] benzoate (PubChem CID 156579185) has the molecular formula C33H37NO5 and a molecular weight of 527.66 g/mol. Its IUPAC name is [3-hydroxy-4-[[(8R,9S,13S,14S,16R,17R)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-methylamino]phenyl] benzoate.
| Compound Name | [3-hydroxy-4-[[(8R,9S,13S,14S,16R,17R)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-methylamino]phenyl] benzoate |
|---|---|
| PubChem CID | 156579185 |
| Molecular Formula | C33H37NO5 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | [3-hydroxy-4-[[(8R,9S,13S,14S,16R,17R)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-methylamino]phenyl] benzoate |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)[C@H](N(C)c3ccc(OC(=O)c4ccccc4)cc3O)C[C@@H]12 |
| InChI | InChI=1S/C33H37NO5/c1-33-16-15-25-24-13-10-22(38-3)17-21(24)9-12-26(25)27(33)19-29(31(33)36)34(2)28-14-11-23(18-30(28)35)39-32(37)20-7-5-4-6-8-20/h4-8,10-11,13-14,17-18,25-27,29,31,35-36H,9,12,15-16,19H2,1-3H3/t25-,26-,27+,29-,31+,33+/m1/s1 |
| InChIKey | CSLZAYYLHAQIOP-ASCGNOJZSA-N |
| XLogP | 5.95 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|