C37H45NO6 — CID 156579157
[3-hydroxy-4-[[(8R,9S,13S,14S,16R,17R)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-methylamino]phenyl] 4-butoxybenzoate (PubChem CID 156579157) has the molecular formula C37H45NO6 and a molecular weight of 599.77 g/mol. Its IUPAC name is [3-hydroxy-4-[[(8R,9S,13S,14S,16R,17R)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-methylamino]phenyl] 4-butoxybenzoate.
| Compound Name | [3-hydroxy-4-[[(8R,9S,13S,14S,16R,17R)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-methylamino]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 156579157 |
| Molecular Formula | C37H45NO6 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | [3-hydroxy-4-[[(8R,9S,13S,14S,16R,17R)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-methylamino]phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(N(C)[C@@H]3C[C@H]4[C@@H]5CCc6cc(OC)ccc6[C@H]5CC[C@]4(C)[C@H]3O)c(O)c2)cc1 |
| InChI | InChI=1S/C37H45NO6/c1-5-6-19-43-25-10-7-23(8-11-25)36(41)44-27-13-16-32(34(39)21-27)38(3)33-22-31-30-14-9-24-20-26(42-4)12-15-28(24)29(30)17-18-37(31,2)35(33)40/h7-8,10-13,15-16,20-21,29-31,33,35,39-40H,5-6,9,14,17-19,22H2,1-4H3/t29-,30-,31+,33-,35+,37+/m1/s1 |
| InChIKey | GFRVTNWABZKLGK-XICREHCYSA-N |
| XLogP | 7.13 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|