C10H14 — CID 101148448
cis-(1S,2S)-1-hexa-1,2,5-trienyl-2-methylcyclopropane (PubChem CID 101148448) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is cis-(1S,2S)-1-hexa-1,2,5-trienyl-2-methylcyclopropane.
| Compound Name | cis-(1S,2S)-1-hexa-1,2,5-trienyl-2-methylcyclopropane |
|---|---|
| PubChem CID | 101148448 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | cis-(1S,2S)-1-hexa-1,2,5-trienyl-2-methylcyclopropane |
| SMILES | C=CCC=C=C[C@H]1C[C@@H]1C |
| InChI | InChI=1S/C10H14/c1-3-4-5-6-7-10-8-9(10)2/h3,5,7,9-10H,1,4,8H2,2H3/t6?,9-,10-/m0/s1 |
| InChIKey | VFMSNLXLMGOCCK-VJCKSVEBSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|