C21H28 — CID 161165849
1-ethenyl-3-[2-(3-methyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl)ethenyl]-1,2,3,3a,4,6a-hexahydropentalene (PubChem CID 161165849) has the molecular formula C21H28 and a molecular weight of 280.45 g/mol. Its IUPAC name is 1-ethenyl-3-[2-(3-methyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl)ethenyl]-1,2,3,3a,4,6a-hexahydropentalene.
| Compound Name | 1-ethenyl-3-[2-(3-methyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl)ethenyl]-1,2,3,3a,4,6a-hexahydropentalene |
|---|---|
| PubChem CID | 161165849 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-ethenyl-3-[2-(3-methyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl)ethenyl]-1,2,3,3a,4,6a-hexahydropentalene |
| SMILES | C=CC1CC(C=CC2CC(C)C3CC=CC23)C2CC=CC12 |
| InChI | InChI=1S/C21H28/c1-3-15-13-17(21-9-5-7-19(15)21)11-10-16-12-14(2)18-6-4-8-20(16)18/h3-5,7-8,10-11,14-21H,1,6,9,12-13H2,2H3 |
| InChIKey | BCOBKPVDWCBYNZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|