C16H26Si — CID 11032177
[(E)-3-[(1S,3R,3aS,6aR)-3-ethenyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl]prop-2-enyl]-trimethylsilane (PubChem CID 11032177) has the molecular formula C16H26Si and a molecular weight of 246.47 g/mol. Its IUPAC name is [(E)-3-[(1S,3R,3aS,6aR)-3-ethenyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl]prop-2-enyl]-trimethylsilane.
| Compound Name | [(E)-3-[(1S,3R,3aS,6aR)-3-ethenyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl]prop-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11032177 |
| Molecular Formula | C16H26Si |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | [(E)-3-[(1S,3R,3aS,6aR)-3-ethenyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl]prop-2-enyl]-trimethylsilane |
| SMILES | C=C[C@H]1C[C@@H](/C=C/C[Si](C)(C)C)[C@H]2C=CC[C@H]21 |
| InChI | InChI=1S/C16H26Si/c1-5-13-12-14(8-7-11-17(2,3)4)16-10-6-9-15(13)16/h5-8,10,13-16H,1,9,11-12H2,2-4H3/b8-7+/t13-,14+,15-,16+/m0/s1 |
| InChIKey | ZTMJYDGLQWFTTA-PPNPPKNSSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|