C36H48 — CID 158812642
1-[(E)-2-cyclohex-3-en-1-ylethenyl]-3-ethenyl-1,2,3,3a,4,6a-hexahydropentalene;4-ethenylcyclohexene;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 158812642) has the molecular formula C36H48 and a molecular weight of 480.78 g/mol. Its IUPAC name is 1-[(E)-2-cyclohex-3-en-1-ylethenyl]-3-ethenyl-1,2,3,3a,4,6a-hexahydropentalene;4-ethenylcyclohexene;tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 1-[(E)-2-cyclohex-3-en-1-ylethenyl]-3-ethenyl-1,2,3,3a,4,6a-hexahydropentalene;4-ethenylcyclohexene;tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 158812642 |
| Molecular Formula | C36H48 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | 1-[(E)-2-cyclohex-3-en-1-ylethenyl]-3-ethenyl-1,2,3,3a,4,6a-hexahydropentalene;4-ethenylcyclohexene;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(C3)C2C1.C=CC1CC(/C=C/C2CC=CCC2)C2C=CCC12.C=CC1CC=CCC1 |
| InChI | InChI=1S/C18H24.C10H12.C8H12/c1-2-15-13-16(18-10-6-9-17(15)18)12-11-14-7-4-3-5-8-14;1-2-9-7-4-5-8(6-7)10(9)3-1;1-2-8-6-4-3-5-7-8/h2-4,6,10-12,14-18H,1,5,7-9,13H2;1-2,4-5,7-10H,3,6H2;2-4,8H,1,5-7H2/b12-11+;; |
| InChIKey | IUWMHVDEYZEEOQ-YHPRVSEPSA-N |
| XLogP | 9.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|