C10H12Br2Pt — CID 23454665
platinum(2+);tricyclo[5.2.1.02,6]deca-3,8-diene;dibromide (PubChem CID 23454665) has the molecular formula C10H12Br2Pt and a molecular weight of 487.09 g/mol. Its IUPAC name is platinum(2+);tricyclo[5.2.1.02,6]deca-3,8-diene;dibromide.
| Compound Name | platinum(2+);tricyclo[5.2.1.02,6]deca-3,8-diene;dibromide |
|---|---|
| PubChem CID | 23454665 |
| Molecular Formula | C10H12Br2Pt |
| Molecular Weight | 487.09 g/mol |
| Exact Mass | 484.90 |
| IUPAC Name | platinum(2+);tricyclo[5.2.1.02,6]deca-3,8-diene;dibromide |
| SMILES | C1=CC2C3C=CC(C3)C2C1.[Br-].[Br-].[Pt+2] |
| InChI | InChI=1S/C10H12.2BrH.Pt/c1-2-9-7-4-5-8(6-7)10(9)3-1;;;/h1-2,4-5,7-10H,3,6H2;2*1H;/q;;;+2/p-2 |
| InChIKey | XHNWTZFZRBSBHD-UHFFFAOYSA-L |
| XLogP | -3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.09 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|