C43H54 — CID 164775813
1-ethenyl-3-[(Z)-2-[4-ethenyl-2,3-bis[(E)-2-(3-ethenyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)ethenyl]cyclopentyl]ethenyl]-1,2,3,3a,4,6a-hexahydropentalene (PubChem CID 164775813) has the molecular formula C43H54 and a molecular weight of 570.90 g/mol. Its IUPAC name is 1-ethenyl-3-[(Z)-2-[4-ethenyl-2,3-bis[(E)-2-(3-ethenyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)ethenyl]cyclopentyl]ethenyl]-1,2,3,3a,4,6a-hexahydropentalene.
| Compound Name | 1-ethenyl-3-[(Z)-2-[4-ethenyl-2,3-bis[(E)-2-(3-ethenyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)ethenyl]cyclopentyl]ethenyl]-1,2,3,3a,4,6a-hexahydropentalene |
|---|---|
| PubChem CID | 164775813 |
| Molecular Formula | C43H54 |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.42 |
| IUPAC Name | 1-ethenyl-3-[(Z)-2-[4-ethenyl-2,3-bis[(E)-2-(3-ethenyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)ethenyl]cyclopentyl]ethenyl]-1,2,3,3a,4,6a-hexahydropentalene |
| SMILES | C=CC1CC(/C=C\C2CC(C=C)C(/C=C/C3CC(C=C)C4C=CCC34)C2/C=C/C2CC(C=C)C3C=CCC23)C2CC=CC12 |
| InChI | InChI=1S/C43H54/c1-5-28-24-32(39-15-9-12-36(28)39)18-19-33-27-31(8-4)42(22-20-34-25-29(6-2)37-13-10-16-40(34)37)43(33)23-21-35-26-30(7-3)38-14-11-17-41(35)38/h5-14,18-23,28-43H,1-4,15-17,24-27H2/b19-18-,22-20+,23-21+ |
| InChIKey | DTQCIKMQQPOBKI-RKERTXFESA-N |
| XLogP | 10.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|