C35H49P — CID 165026935
3-[(Z)-2-[2,4-bis(ethenyl)-3-prop-2-enylcyclopentyl]ethenyl]-1-ethenyl-1,2,3,3a,4,6a-hexahydropentalene;dideuteriomethylphosphane;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 165026935) has the molecular formula C35H49P and a molecular weight of 502.76 g/mol. Its IUPAC name is 3-[(Z)-2-[2,4-bis(ethenyl)-3-prop-2-enylcyclopentyl]ethenyl]-1-ethenyl-1,2,3,3a,4,6a-hexahydropentalene;dideuteriomethylphosphane;tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 3-[(Z)-2-[2,4-bis(ethenyl)-3-prop-2-enylcyclopentyl]ethenyl]-1-ethenyl-1,2,3,3a,4,6a-hexahydropentalene;dideuteriomethylphosphane;tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 165026935 |
| Molecular Formula | C35H49P |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | 3-[(Z)-2-[2,4-bis(ethenyl)-3-prop-2-enylcyclopentyl]ethenyl]-1-ethenyl-1,2,3,3a,4,6a-hexahydropentalene;dideuteriomethylphosphane;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(C3)C2C1.C=CCC1C(C=C)CC(/C=C\C2CC(C=C)C3C=CCC23)C1C=C.[2H]C([2H])P |
| InChI | InChI=1S/C24H32.C10H12.CH5P/c1-5-10-22-17(6-2)15-19(21(22)8-4)13-14-20-16-18(7-3)23-11-9-12-24(20)23;1-2-9-7-4-5-8(6-7)10(9)3-1;1-2/h5-9,11,13-14,17-24H,1-4,10,12,15-16H2;1-2,4-5,7-10H,3,6H2;2H2,1H3/b14-13-;;/i;;1D2 |
| InChIKey | MASNKUUBZAYYCH-HYLJXCBPSA-N |
| XLogP | 9.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|