C36H54N+ — CID 58301036
2-[4-ethenyl-2-[(Z)-2-[3-ethenyl-4-[(Z)-2-(3-ethenyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)ethenyl]-2-prop-2-enylcyclopentyl]ethenyl]-1-methylcyclopentyl]ethyl-dimethylazanium (PubChem CID 58301036) has the molecular formula C36H54N+ and a molecular weight of 500.84 g/mol. Its IUPAC name is 2-[4-ethenyl-2-[(Z)-2-[3-ethenyl-4-[(Z)-2-(3-ethenyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)ethenyl]-2-prop-2-enylcyclopentyl]ethenyl]-1-methylcyclopentyl]ethyl-dimethylazanium.
| Compound Name | 2-[4-ethenyl-2-[(Z)-2-[3-ethenyl-4-[(Z)-2-(3-ethenyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)ethenyl]-2-prop-2-enylcyclopentyl]ethenyl]-1-methylcyclopentyl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 58301036 |
| Molecular Formula | C36H54N+ |
| Molecular Weight | 500.84 g/mol |
| Exact Mass | 500.43 |
| IUPAC Name | 2-[4-ethenyl-2-[(Z)-2-[3-ethenyl-4-[(Z)-2-(3-ethenyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)ethenyl]-2-prop-2-enylcyclopentyl]ethenyl]-1-methylcyclopentyl]ethyl-dimethylazanium |
| SMILES | C=CCC1C(/C=C\C2CC(C=C)CC2(C)CC[NH+](C)C)CC(/C=C\C2CC(C=C)C3C=CCC23)C1C=C |
| InChI | InChI=1S/C36H53N/c1-8-13-33-30(18-19-31-22-26(9-2)25-36(31,5)20-21-37(6)7)24-28(32(33)11-4)16-17-29-23-27(10-3)34-14-12-15-35(29)34/h8-12,14,16-19,26-35H,1-4,13,15,20-25H2,5-7H3/p+1/b17-16-,19-18- |
| InChIKey | OKFOIISAEFOKKC-BLLVGQQCSA-O |
| XLogP | 7.50 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.84 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|