C39H50O4 — CID 161229339
ethyl 2-ethyl-3-[2-(3-methyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl)ethenyl]-5-[2-[3-[2-(4-prop-2-enoyloxyphenyl)ethenyl]cyclopentyl]ethenyl]cyclopentane-1-carboxylate (PubChem CID 161229339) has the molecular formula C39H50O4 and a molecular weight of 582.83 g/mol. Its IUPAC name is ethyl 2-ethyl-3-[2-(3-methyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl)ethenyl]-5-[2-[3-[2-(4-prop-2-enoyloxyphenyl)ethenyl]cyclopentyl]ethenyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl 2-ethyl-3-[2-(3-methyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl)ethenyl]-5-[2-[3-[2-(4-prop-2-enoyloxyphenyl)ethenyl]cyclopentyl]ethenyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 161229339 |
| Molecular Formula | C39H50O4 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | ethyl 2-ethyl-3-[2-(3-methyl-1,2,3,3a,4,6a-hexahydropentalen-1-yl)ethenyl]-5-[2-[3-[2-(4-prop-2-enoyloxyphenyl)ethenyl]cyclopentyl]ethenyl]cyclopentane-1-carboxylate |
| SMILES | C=CC(=O)Oc1ccc(C=CC2CCC(C=CC3CC(C=CC4CC(C)C5CC=CC45)C(CC)C3C(=O)OCC)C2)cc1 |
| InChI | InChI=1S/C39H50O4/c1-5-34-31(20-19-30-23-26(4)35-9-8-10-36(30)35)25-32(38(34)39(41)42-7-3)18-15-29-14-13-28(24-29)12-11-27-16-21-33(22-17-27)43-37(40)6-2/h6,8,10-12,15-22,26,28-32,34-36,38H,2,5,7,9,13-14,23-25H2,1,3-4H3 |
| InChIKey | MSACBOPOHHXZGD-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|