C15H20O3 — CID 20607916
2-(10-tricyclo[5.2.1.02,6]dec-3-enyloxy)ethyl prop-2-enoate (PubChem CID 20607916) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-(10-tricyclo[5.2.1.02,6]dec-3-enyloxy)ethyl prop-2-enoate.
| Compound Name | 2-(10-tricyclo[5.2.1.02,6]dec-3-enyloxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 20607916 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-(10-tricyclo[5.2.1.02,6]dec-3-enyloxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC1C2CCC1C1CC=CC12 |
| InChI | InChI=1S/C15H20O3/c1-2-14(16)17-8-9-18-15-12-6-7-13(15)11-5-3-4-10(11)12/h2-4,10-13,15H,1,5-9H2 |
| InChIKey | VPQCXNHTQSRYAT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|