About 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate
2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate (PubChem CID 144910594) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate |
| PubChem CID | 144910594 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC1OC(O)CCC1O |
| InChI | InChI=1S/C10H16O6/c1-2-8(12)14-5-6-15-10-7(11)3-4-9(13)16-10/h2,7,9-11,13H,1,3-6H2 |
| InChIKey | IILAEDOHMWJOMP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate?
The IUPAC name of 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate (CID 144910594) is 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate.
What is the SMILES notation for 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate?
The canonical SMILES for 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate is C=CC(=O)OCCOC1OC(O)CCC1O.
What is the InChIKey of 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate?
The InChIKey is IILAEDOHMWJOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O6/c1-2-8(12)14-5-6-15-10-7(11)3-4-9(13)16-10/h2,7,9-11,13H,1,3-6H2.
What are the key properties of 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate?
2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate has a molecular weight of 232.23 g/mol, XLogP of -0.45, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dihydroxyoxan-2-yl)oxyethyl prop-2-enoate is sourced from PubChem (CID 144910594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).