C17H25NO2 — CID 176803426
2-[[(2S)-10,10-dimethyl-8-tricyclo[5.2.1.02,6]dec-3-enyl]amino]ethyl prop-2-enoate (PubChem CID 176803426) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-[[(2S)-10,10-dimethyl-8-tricyclo[5.2.1.02,6]dec-3-enyl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[[(2S)-10,10-dimethyl-8-tricyclo[5.2.1.02,6]dec-3-enyl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 176803426 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-[[(2S)-10,10-dimethyl-8-tricyclo[5.2.1.02,6]dec-3-enyl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC1CC2[C@H]3C=CCC3C1C2(C)C |
| InChI | InChI=1S/C17H25NO2/c1-4-15(19)20-9-8-18-14-10-13-11-6-5-7-12(11)16(14)17(13,2)3/h4-6,11-14,16,18H,1,7-10H2,2-3H3/t11-,12?,13?,14?,16?/m0/s1 |
| InChIKey | YDBCXRCPNBOLHB-IKMFHRHGSA-N |
| XLogP | 2.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|